Online Database of Chemicals from Around the World
| Product Name | CAS Registry Number | Molecular Formula |
|---|---|---|
| Thiophosphoric Acid O,O-Diethyl O-(2-Chloro-4-Nitrophenyl) Ester | 6012-87-9 | C10H13ClNO5PS |
| Thiophosphoric Acid O,O-Diethyl O-(Coumarin-3-Yl) Ester | 4935-28-8 | C13H15O5PS |
| Thiophosphoric Acid O,O'-Diethyl Ester-S-(2-Dimethylamino-Ethyl Ester) | 3147-20-4 | C10H22NO7PS |
| Thiophosphoric Acid O,O-Diethyl O-[2-(Ethylsulfinyl)Ethyl] Ester | 5286-73-7 | C8H19O4PS2 |
| Thiophosphoric Acid O,O-Diethyl O-(6-Fluoro-2-Pyridinyl) Ester | 39624-86-7 | C9H13FNO3PS |
| Thiophosphoric Acid O,O-Diethyl O-(2-Propyl-6-Methylpyrimidin-4-Yl) Ester | 5826-91-5 | C12H21N2O3PS |
| Thiophosphoric Acid O,O-Diethyl O-[2-[(Sec-Butoxymethyl)Thio]Ethyl] Ester | 5823-11-0 | C11H25O4PS2 |
| Thiophosphoric Acid O,O-Diethyl S-(3,4,4-Trifluoro-3-Butenyl) Ester | 16499-75-5 | C8H14F3O3PS |
| Thiophosphoric Acid Dihydrogen S-(2-Amino-2-Methylpropyl) Ester | 7447-44-1 | C4H12NO3PS |
| Thiophosphoric Acid Dihydrogen S-(3-Aminopropyl) Ester | 63717-20-4 | C3H10NO3PS |
| Thiophosphoric acid, O,O'-diisopropyl ester | 4486-44-6 | C6H15O3PS |
| Thiophosphoric Acid O,O-Dimethyl O-(2-Chloro-4-Cyanophenyl) Ester | 63981-11-3 | C9H9ClNO3PS |
| Thiophosphoric Acid O,O-Dimethyl O-[(3,4-Dihydro-4-Oxo-1,2,3-Benzotriazin-3-Yl)Methyl] Ester | 24736-01-4 | C10H12N3O4PS |
| Thiophosphoric Acid O,O-Dimethyl O-(4-Methyl-7-Coumarinyl) Ester | 5826-85-7 | C12H13O5PS |
| Thiophosphoric Acid O,S-Dimethyl O-[4-(Methylthio)-3-Methylphenyl] Ester | 28397-59-3 | C10H15O3PS2 |
| Thiophosphoric Acid O,O-Dimethyl O-(3-Nitrophenyl) Ester | 620-29-1 | C8H10NO5PS |
| Thiophosphoric Acid O-Ethyl O-Furfuryl S-(2-Propynyl) Ester | 63980-87-0 | C10H13O4PS |
| Thiophosphoric Acid O-Ethyl O-Isopropyl O-(1,6-Dihydro-5-Methoxy-6-Oxo-1-Phenylpyridazin-4-Yl) Ester | 59631-22-0 | C16H21N2O5PS |
| Thiophosphoric Acid O-[2-(Ethylsulfonyl)Ethyl]O, O-Dimethyl Ester | 25476-48-6 | C6H15O5PS2 |
| Thiophosphoric Acid O-Furfuryl O-Methyl S-(2-Propynyl) Ester | 63980-90-5 | C9H11O4PS |
| Thiophosphoric Acid Hydrogen O-Ethyl S-(p-Tolyl) Ester | 63980-89-2 | C9H13O3PS |
| Thiophosphoric Acid O,O,O-Tris[2-Chloro-1-(Chloromethyl)Ethyl] Ester | 29081-63-8 | C9H15Cl6O3PS |
| Thiophosphoric Acid O,O,O-Tris(2-Chloro-1-Methylethyl) Ester | 6044-12-8 | C14H18N2O3S |
| Thiophosphoryl Bromide | 3931-89-3 | Br3PS |
| Thiophosphoryl-Pmmh-48 Dendrimer | 313691-80-4 | |
| Thio-Picolinic Acid O-Butyl Ester | 5613-16-1 | C25H31NO4 |
| Thiopivalic acid | 55561-02-9 | C5H10OS |
| L-Thioproline | 34592-47-7 | C4H7NO2S |
| Thiopropazate | 84-06-0 | C23H30Cl3N3O2S |
| Thioproperazine | 316-81-4 | C22H30N4O2S2 |
| Thioproperazine Difumarate | 123937-18-8 | C30H38N4O10S2 |
| Thioproperazine dimesylate | 2347-80-0 | C22H30N4O2S2.2(CH4O3S) |
| Thiopropionamide | 631-58-3 | C3H7NS |
| Thiopropionic Acid | 1892-31-5 | C3H6OS |
| 4-Thiopseudouridine | 55101-24-1 | C9H12N2O5S |
| Thiopurinol Ribonucleoside | 54524-71-9 | C10H12N4O4S |
| Thiopurinol Ribonucleoside Monophosphate | 81944-82-3 | C10H13N4O7PS |
| 2H-Thiopyran-3,5(4H,6H)-dione | 6881-49-8 | C5H6O2S |
| Thiopyran-4-One | 1003-41-4 | C5H4OS |
| 2H-Thiopyran-3(6H)-One | 29431-30-9 | C5H6OS |
| 5H-Thiopyrano[4,3-d][1,2]oxazol-4(7H)-one | 95502-26-4 | C6H5NO2S |
| 5H-Thiopyrano[4,3-d]Pyrimidine | 253-89-4 | C7H6N2S |
| 5H-Thiopyrano[2,3-d]Pyrimidine | 254-72-8 | C7H6N2S |
| 6H-Thiopyrano[3,2-d]Pyrimidine | 33526-08-8 | C7H6N2S |
| 1H-Thiopyrano[3,4-d]Pyrimidine | 36338-64-4 | C7H6N2S |
| 1H-Thiopyrano[3,2-d]Pyrimidine | 42377-24-2 | C7H6N2S |
| 7H-Thiopyrano[2,3-d]pyrimidine | 874-28-2 | C7H6N2S |
| Thiopyran-4-Thione | 1120-94-1 | C5H4S2 |
| Thioquinapiperifil Dihydrochloride | 204077-66-7 | C26H30N4OS |
| Thioquinox | 93-75-4 | C9H4N2S3 |